BIOPEP-UWM: Report
| ID | 603 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 3 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 328.4061 | Monoisotopic mass | 328.2104 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Park J.-N., Ishida K., Watanabe T., Endoh K., Watanabe K., Murakami M., Abe H. | |
| Title | |
| Taste effects of oligopeptides in a Vietnamese fish sauce. Fisheries Sci., 68, 921-928, 2002 | |
| Year | Source |
| 2002 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CCCN)C(=O)O InChI=1S/C15H28N4O4/c1-9(2)12(17)14(21)19-8-4-6-11(19)13(20)18-10(15(22)23)5-3-7-16/h9-12H,3-8,16-17H2,1-2H3,(H,18,20)(H,22,23)/t10-,11-,12-/m0/s1 InChIKey=DIGWTZHSJUWUCS-SRVKXCTJSA-N {Orn} - Ornithine (ID 256 in the BIOPEP-UWM repository of amino acids and modifications) Umami/sweet taste in 0.3% NaCl |
| Database reference: |