BIOPEP-UWM: Report
| ID | 605 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 228.2873 | Monoisotopic mass | 228.1469 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asao M., Iwamura H., Akamatsu M., Fujita T. | |
| Title | |
| Quantitative structure-activity relationships of the bitter thresholds of amino acids, peptides, and their derivatives. J. Med. Chem., 30, 1873-1879, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)O InChI=1S/C11H20N2O3/c1-3-7(2)9(11(15)16)13-10(14)8-5-4-6-12-8/h7-9,12H,3-6H2,1-2H3,(H,13,14)(H,15,16)/t7-,8-,9-/m0/s1 InChIKey=OCYROESYHWUPBP-CIUDSAMLSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8857) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 8857 CAS: Registry No 51926-51-3 ChEBI: ID 74790 ChemSpider: ID 5430866 ChEMBL: ID CHEMBL55967 EPA DSSTOX: ID DTXCID501393895 FooDB: ID FDB098399 HMDB: ID HMDB0304810 J-GLOBAL: ID 200907053275033924 Metabolomics Workbench: ID 78945 Nikkaji: ID J149.650F PubChem: CID 7079601 SureChEMBL: ID 8720606 Wikidata: ID Q27144901 ZINC: ID ZINC000004030027 |