BIOPEP-UWM: Report
| ID | 606 |
| Name | Bitter peptide |
| sequence |
| Function: | |||
| Bitter taste | |||
| Number of residues | 2 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 214.2608 | Monoisotopic mass | 214.1313 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Asao M., Iwamura H., Akamatsu M., Fujita T. | |
| Title | |
| Quantitative structure-activity relationships of the bitter thresholds of amino acids, peptides, and their derivatives. J. Med. Chem., 30, 1873-1879, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C10H18N2O3/c1-6(2)8(10(14)15)12-9(13)7-4-3-5-11-7/h6-8,11H,3-5H2,1-2H3,(H,12,13)(H,14,15)/t7-,8-/m0/s1 InChIKey=AWJGUZSYVIVZGP-YUMQZZPRSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8864) |
| Database reference: |
| ACToR: ID 20488-27-1 BIOPEP-UWM database of bioactive peptides: ID 8864 BRENDA: Ligand Pro-Val CAS: REgistry No 52899-09-9 ChEBI: ID 74800 ChEMBL: ID CHEMBL59096 ChemSpider: ID 134246 ECHA: ID 109-172-2 EPA DSSTox: ID DTXSID90942662 J-GLOBAL: ID 200907005683208533 MetaboLights: ID MTBLC74800 Nikkaji: ID J149.646H NMRShiftDB: ID 60021756 PubChem: CID 152307 SureChEMBL: ID 6401404 UniChem: ID 436133 Wikidata: ID Q27144911 ZINC: ID ZINC000001572030 |