BIOPEP-UWM: Report
| ID | 61 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 50 | |||
| Number of residues | 5 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 721.8475 | Monoisotopic mass | 721.4013 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishibashi N., Sadamori K., Yamamoto O., Kanehisa H., Kouge K., Kikuchi E., Okai H., Fukui S. | |
| Title | |
| Bitterness of phenylalanine- and tyrosine-containing peptides. Agric. Biol. Chem., 51, 3309-3313, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O InChI=1S/C35H51N11O6/c36-24(14-7-17-41-34(37)38)29(47)43-25(15-8-18-42-35(39)40)32(50)46-19-9-16-28(46)31(49)44-26(20-22-10-3-1-4-11-22)30(48)45-27(33(51)52)21-23-12-5-2-6-13-23/h1-6,10-13,24-28H,7-9,14-21,36H2,(H,43,47)(H,44,49)(H,45,48)(H,51,52)(H4,37,38,41)(H4,39,40,42)/t24-,25-,26-,27-,28+/m0/s1 InChIKey: VCBIUMCVKLZUPY-OBBCHVIHSA-N |
| Database reference: |