BIOPEP-UWM: Report
| ID | 611 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 7 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 594.5730 | Monoisotopic mass | 594.2390 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li J., Chen J., Lv H., Benjakul S., Zhang Y., Fu Y. | |
| Title | |
| Enzyme-specific release dynamics of umami and bitter peptides from shrimp processing by-products: a machine learning-aided study. Food Chem., 519 149646, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])(CC(=O)N)C(=O)NCC(=O)N[C@@]([H])(CO)C(=O)NCC(=O)NCC(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C24H34N8O10/c25-14(7-17(26)34)22(39)29-11-21(38)32-16(12-33)23(40)30-9-19(36)27-8-18(35)28-10-20(37)31-15(24(41)42)6-13-4-2-1-3-5-13/h1-5,14-16,33H,6-12,25H2,(H2,26,34)(H,27,36)(H,28,35)(H,29,39)(H,30,40)(H,31,37)(H,32,38)(H,41,42)/t14-,15-,16-/m0/s1 InChIKey=HBJKCMIZUUFCIW-JYJNAYRXSA-N |
| Database reference: |