BIOPEP-UWM: Report
| ID | 614 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 6 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 729.7374 | Monoisotopic mass | 729.3395 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li J., Chen J., Lv H., Benjakul S., Zhang Y., Fu Y. | |
| Title | |
| Enzyme-specific release dynamics of umami and bitter peptides from shrimp processing by-products: a machine learning-aided study. Food Chem., 519 149646, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C28H47N11O12/c1-12(40)21(38-22(45)13(29)10-20(43)44)25(48)37-16(11-19(31)42)26(49)39-9-3-5-17(39)24(47)35-14(6-7-18(30)41)23(46)36-15(27(50)51)4-2-8-34-28(32)33/h12-17,21,40H,2-11,29H2,1H3,(H2,30,41)(H2,31,42)(H,35,47)(H,36,46)(H,37,48)(H,38,45)(H,43,44)(H,50,51)(H4,32,33,34)/t12-,13+,14+,15+,16+,17+,21+/m1/s1 InChIKey=OPTJTQIRDRVWKX-WQRZYWPASA-N |
| Database reference: |