BIOPEP-UWM: Report
| ID | 615 |
| Name | Umami peptide |
| sequence |
| Function: | |||
| Umami taste | |||
| Number of residues | 5 |
Activity code | um |
| Activity : | umami |
|||
| Chemical mass | 618.6356 | Monoisotopic mass | 618.2963 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li J., Chen J., Lv H., Benjakul S., Zhang Y., Fu Y. | |
| Title | |
| Enzyme-specific release dynamics of umami and bitter peptides from shrimp processing by-products: a machine learning-aided study. Food Chem., 519 149646, 2026 | |
| Year | Source |
| 2026 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C24H42N8O11/c1-11(2)18(25)22(41)30-13(6-8-17(36)37)20(39)32-15(10-33)21(40)29-12(5-7-16(34)35)19(38)31-14(23(42)43)4-3-9-28-24(26)27/h11-15,18,33H,3-10,25H2,1-2H3,(H,29,40)(H,30,41)(H,31,38)(H,32,39)(H,34,35)(H,36,37)(H,42,43)(H4,26,27,28)/t12-,13-,14-,15-,18-/m0/s1 InChIKey=GJEBWDIMNJUMMX-PQKJENKHSA-N |
| Database reference: |