BIOPEP-UWM: Report
| ID | 73 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 3.3 | |||
| Number of residues | 3 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 425.4765 | Monoisotopic mass | 425.1944 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ishibashi N., Kubo T., Chino M., Fukui H., Shinoda I., Kikuchi E., Okai H., Fukui S. | |
| Title | |
| Taste of proline-containing peptides. Agric. Biol. Chem., 52, 95-98, 1988 | |
| Year | Source |
| 1988 | Journal |
| Additional information: |
| BIOPEP-UWM database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N1[C@H](C(=O)N[C@H](C(=O)O)Cc2ccccc2)CCC1)Cc1ccc(cc1)O InChI=1S/C23H27N3O5/c24-18(13-16-8-10-17(27)11-9-16)22(29)26-12-4-7-20(26)21(28)25-19(23(30)31)14-15-5-2-1-3-6-15/h1-3,5-6,8-11,18-20,27H,4,7,12-14,24H2,(H,25,28)(H,30,31)/t18-,19-,20-/m0/s1 InChIKey: RCMWNNJFKNDKQR-UFYCRDLUSA-N Opioid peptide according to the BindingDB database; the BIOPEP database of bioactive peptides; the ChEMBL database; the EROP-Moscow database; the PubChem database Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database |
| Database reference: |
| AHTPDB: ID 2291; 4597; 4855; 5511; 5939 BindingDB: ID 50139021 BioPepDB: ID biopep01592 BIOPEP-UWM database of bioactive peptides: ID 2870 BRENDA: Ligand Tyr-Pro-Phe ChEMBL: ID CHEMBL164030 ChemSpider: ID 8178106 EPA DSSTox: ID DTXCID50356261 EROP-Moscow: ID E09283 J-GLOBAL: ID 200907066679107020 Nikkaji: ID J394.110H PubChem: CID 10002525 SATPdb: ID satpdb17904 ZINC: ID ZINC13542109 |