BIOPEP-UWM: Report
| ID | 75 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 143 | |||
| Number of residues | 6 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 818.9624 | Monoisotopic mass | 818.4539 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Nosho Y., Shinoda I., Fukui H., Okai H. | |
| Title | |
| Studies on a model bitter peptides including arginine, proline and phenylalanine residues. I. Bitter taste of di- and tripeptides and bitterness increase of the model peptides by extension of the peptide chain. Agric. Biol. Chem., 49, 1019-1026, 1985 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O InChI=1S/C40H58N12O7/c41-27(15-7-19-46-39(42)43)33(53)48-28(16-8-20-47-40(44)45)36(56)52-22-10-18-32(52)37(57)51-21-9-17-31(51)35(55)49-29(23-25-11-3-1-4-12-25)34(54)50-30(38(58)59)24-26-13-5-2-6-14-26/h1-6,11-14,27-32H,7-10,15-24,41H2,(H,48,53)(H,49,55)(H,50,54)(H,58,59)(H4,42,43,46)(H4,44,45,47)/t27-,28-,29-,30-,31-,32-/m0/s1 InChIKey: SQOYPMHZZPOJKO-JNRWAQIZSA-N |
| Database reference: |