BIOPEP-UWM: Report
| ID | 76 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 50 | |||
| Number of residues | 7 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 907.0656 | Monoisotopic mass | 906.4738 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Nosho Y., Shinoda I., Fukui H., Okai H. | |
| Title | |
| Studies on a model bitter peptides including arginine, proline and phenylalanine residues. I. Bitter taste of di- and tripeptides and bitterness increase of the model peptides by extension of the peptide chain. Agric. Biol. Chem., 49, 1019-1026, 1985 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O InChI=1S/C48H62N10O8/c49-34(20-10-24-52-48(50)51)44(62)57-26-12-22-39(57)46(64)58-27-13-23-40(58)45(63)56-25-11-21-38(56)43(61)54-36(29-32-16-6-2-7-17-32)41(59)53-35(28-31-14-4-1-5-15-31)42(60)55-37(47(65)66)30-33-18-8-3-9-19-33/h1-9,14-19,34-40H,10-13,20-30,49H2,(H,53,59)(H,54,61)(H,55,60)(H,65,66)(H4,50,51,52)/t34-,35-,36-,37-,38-,39-,40-/m0/s1 InChIKey: PMQCSESQXFXMIA-OAKHNGAUSA-N |
| Database reference: |