BIOPEP-UWM: Report
| ID | 77 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 500 | |||
| Number of residues | 8 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 1063.2508 | Monoisotopic mass | 1062.5747 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Nosho Y., Shinoda I., Fukui H., Okai H. | |
| Title | |
| Studies on a model bitter peptides including arginine, proline and phenylalanine residues. I. Bitter taste of di- and tripeptides and bitterness increase of the model peptides by extension of the peptide chain. Agric. Biol. Chem., 49, 1019-1026, 1985 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O InChI=1S/C54H74N14O9/c55-37(21-10-26-60-53(56)57)45(69)62-38(22-11-27-61-54(58)59)49(73)67-29-13-24-43(67)51(75)68-30-14-25-44(68)50(74)66-28-12-23-42(66)48(72)64-40(32-35-17-6-2-7-18-35)46(70)63-39(31-34-15-4-1-5-16-34)47(71)65-41(52(76)77)33-36-19-8-3-9-20-36/h1-9,15-20,37-44H,10-14,21-33,55H2,(H,62,69)(H,63,70)(H,64,72)(H,65,71)(H,76,77)(H4,56,57,60)(H4,58,59,61)/t37-,38-,39-,40-,41-,42-,43-,44-/m0/s1 InChIKey: NWSIHNRCXQDKEX-YTAGXALCSA-N |
| Database reference: |