BIOPEP-UWM: Report
| ID | 78 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 20 | |||
| Number of residues | 7 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 784.9428 | Monoisotopic mass | 784.4582 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Nosho Y., Shinoda I., Fukui H., Okai H. | |
| Title | |
| Studies on a model bitter peptides including arginine, proline and phenylalanine residues. I. Bitter taste of di- and tripeptides and bitterness increase of the model peptides by extension of the peptide chain. Agric. Biol. Chem., 49, 1019-1026, 1985 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)NCC(=O)N1[C@@H](CCC1)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](C(C)C)C(=O)O InChI=1S/C38H60N10O8/c1-5-23(4)31(35(53)45-30(22(2)3)37(55)56)46-33(51)26(20-24-12-7-6-8-13-24)44-34(52)27-15-10-19-48(27)36(54)28-16-11-18-47(28)29(49)21-43-32(50)25(39)14-9-17-42-38(40)41/h6-8,12-13,22-23,25-28,30-31H,5,9-11,14-21,39H2,1-4H3,(H,43,50)(H,44,52)(H,45,53)(H,46,51)(H,55,56)(H4,40,41,42)/t23-,25-,26-,27-,28-,30-,31-/m0/s1 InChIKey: QPQDSGAKQVYPBB-SVQLIUDZSA-N |
| Database reference: |
| EROP-Moscow: ID E01919 |