BIOPEP-UWM: Report
| ID | 79 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 20 | |||
| Number of residues | 10 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 1140.2868 | Monoisotopic mass | 1139.5746 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Otagiri K., Nosho Y., Shinoda I., Fukui H., Okai H. | |
| Title | |
| Studies on a model bitter peptides including arginine, proline and phenylalanine residues. I. Bitter taste of di- and tripeptides and bitterness increase of the model peptides by extension of the peptide chain. Agric. Biol. Chem., 49, 1019-1026, 1985 | |
| Year | Source |
| 1985 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)N[C@H](C(=O)N1[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)N3[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)O)Cc4[nH]cnc4)CC(=O)N)[C@H](CC)C)CCC3)CCC2)Cc2ccccc2)CCC1)Cc1ccc(cc1)O)C(C)C InChI=1S/C56H77N13O13/c1-5-32(4)47(52(77)62-37(27-44(57)71)48(73)65-40(56(81)82)26-35-28-59-30-61-35)66-45(72)29-60-49(74)41-14-9-22-68(41)55(80)43-16-11-23-69(43)54(79)38(24-33-12-7-6-8-13-33)63-50(75)42-15-10-21-67(42)53(78)39(64-51(76)46(58)31(2)3)25-34-17-19-36(70)20-18-34/h6-8,12-13,17-20,28,30-32,37-43,46-47,70H,5,9-11,14-16,21-27,29,58H2,1-4H3,(H2,57,71)(H,59,61)(H,60,74)(H,62,77)(H,63,75)(H,64,76)(H,65,73)(H,66,72)(H,81,82)/t32-,37-,38-,39-,40-,41-,42-,43-,46-,47-/m0/s1 InChIKey: KNDSZALQYQAFRY-UASFGJDDSA-N |
| Database reference: |