BIOPEP-UWM: Report
| ID | 85 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 0.5 | |||
| Number of residues | 4 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 524.6154 | Monoisotopic mass | 524.3175 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shinoda I., Nosho Y., Kouge K., Ishibashi N., Okai H., Tatsumi K., Kikuchi E. | |
| Title | |
| Variation in bitterness potency when introducing Gly-Gly residue into bitter peptides. Agric. Biol. Chem., 51, 2103-2110, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@@H]1C(=O)N1CCC[C@@H]1C(=O)O InChI=1S/C22H40N10O5/c23-13(5-1-9-28-21(24)25)17(33)30-14(6-2-10-29-22(26)27)18(34)31-11-3-7-15(31)19(35)32-12-4-8-16(32)20(36)37/h13-16H,1-12,23H2,(H,30,33)(H,36,37)(H4,24,25,28)(H4,26,27,29)/t13-,14-,15+,16+/m0/s1 InChIKey: HMPZHCDSDLMPJF-CAOSSQGBSA-N |
| Database reference: |