BIOPEP-UWM: Report
| ID | 87 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 8.33 | |||
| Number of residues | 6 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 679.7647 | Monoisotopic mass | 679.3432 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shinoda I., Nosho Y., Kouge K., Ishibashi N., Okai H., Tatsumi K., Kikuchi E. | |
| Title | |
| Variation in bitterness potency when introducing Gly-Gly residue into bitter peptides. Agric. Biol. Chem., 51, 2103-2110, 1987 | |
| Year | Source |
| 1987 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)NCC(=O)NCC(=O)O InChI=1S/C33H45N9O7/c34-23(13-7-15-37-33(35)36)32(49)42-16-8-14-26(42)31(48)41-25(18-22-11-5-2-6-12-22)30(47)40-24(17-21-9-3-1-4-10-21)29(46)39-19-27(43)38-20-28(44)45/h1-6,9-12,23-26H,7-8,13-20,34H2,(H,38,43)(H,39,46)(H,40,47)(H,41,48)(H,44,45)(H4,35,36,37)/t23-,24-,25-,26+/m0/s1 InChIKey: PKGTWSIUROJLIE-ASDGIDEWSA-N |
| Database reference: |