BIOPEP-UWM: Report
| ID | 93 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 3.3 | |||
| Number of residues | 4 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 426.4646 | Monoisotopic mass | 426.1897 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tamura M., Miyoshi T., Mori N., Kinomura K., Kawaguchi M., Ishibashi N., Okai H. | |
| Title | |
| Mechanism of bitter casting potency of peptides using O-aminoacyl sugars as model compounds. Agric. Biol. Chem., 54, 1401-1409, 1990 | |
| Year | Source |
| 1990 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@H](C(=O)NCC(=O)N[C@H](C(=O)NCC(=O)O)Cc1ccccc1)Cc1ccccc1 InChI=1S/C22H26N4O5/c23-17(11-15-7-3-1-4-8-15)21(30)24-13-19(27)26-18(22(31)25-14-20(28)29)12-16-9-5-2-6-10-16/h1-10,17-18H,11-14,23H2,(H,24,30)(H,25,31)(H,26,27)(H,28,29)/t17-,18-/m0/s1 InChIKey: QVOBNSFUVPLVPE-ROUUACIJSA-N First reference concerning bitterness: Asao M., Iwamura H., Akamatsu M., Fujita T., 1987, Quantitative structure-activity relationships of the bitter thresholds of amino acids, peptides, and their derivatives. J. Med. Chem., 30, 1873-1879 |
| Database reference: |
| ChEMBL: ID CHEMBL57082 ChemSpider: ID 18759802 |