BIOPEP-UWM: Report
| ID | 95 |
| Name | bitter peptide |
| sequence |
| Function: | |||
| (Rcaf) 100 | |||
| Number of residues | 8 |
Activity code | bi |
| Activity : | bitter |
|||
| Chemical mass | 1113.3094 | Monoisotopic mass | 1112.5903 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Tamura M., Miyoshi T., Mori N., Kinomura K., Kawaguchi M., Ishibashi N., Okai H. | |
| Title | |
| Mechanism of bitter casting potency of peptides using O-aminoacyl sugars as model compounds. Agric. Biol. Chem., 54, 1401-1409, 1990 | |
| Year | Source |
| 1990 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O InChI=1S/C58H76N14O9/c59-41(25-13-29-64-57(60)61)54(78)71-31-15-27-47(71)52(76)68-44(34-38-19-7-2-8-20-38)50(74)67-43(33-37-17-5-1-6-18-37)49(73)66-42(26-14-30-65-58(62)63)55(79)72-32-16-28-48(72)53(77)69-45(35-39-21-9-3-10-22-39)51(75)70-46(56(80)81)36-40-23-11-4-12-24-40/h1-12,17-24,41-48H,13-16,25-36,59H2,(H,66,73)(H,67,74)(H,68,76)(H,69,77)(H,70,75)(H,80,81)(H4,60,61,64)(H4,62,63,65)/t41-,42-,43-,44-,45-,46-,47+,48+/m0/s1 InChIKey: OESALYUDMODVNZ-PEJOYMIESA-N |
| Database reference: |