BIOPEP-UWM: Report
| ID | 1 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Predicted ligand of SARS-CoV-2 spike protein (PDB ID: 6VXX) | |||
| Number of residues | 4 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 522.5072 | Monoisotopic mass | 522.2067 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhao W., Xu G., Yu Z., Li J., Liu J | |
| Title | |
| Identification of nut protein-derived peptides against SARS-CoV-2 spike protein and main protease. Computers Biol. Med., 138, 104937, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@H](CC(=O)N)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O InChI=1S/C22H30N6O9/c23-12(9-17(25)30)19(33)27-14(10-18(31)32)21(35)26-13(6-7-16(24)29)20(34)28-15(22(36)37)8-11-4-2-1-3-5-11/h1-5,12-15H,6-10,23H2,(H2,24,29)(H2,25,30)(H,26,35)(H,27,33)(H,28,34)(H,31,32)(H,36,37)/t12-,13-,14-,15-/m0/s1 InChIKey=NUMZUCGBKBLPGP-AJNGGQMLSA-N Bioactivity predicted using molecular docking |
| Database reference: |