BIOPEP-UWM: Report
| ID | 10 |
| Name | DPPIV inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Dipeptidyl peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) (PDB ID: 1PFQ) | |||
| Number of residues | 10 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 990.0648 | Monoisotopic mass | 989.4802 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Garzón A. G., Veras F. F., Brandelli A., Drago S. R. | |
| Title | |
| Purification, identification and in silico studies of antioxidant, antidiabetogenic and antibacterial peptides obtained from sorghum spent grain hydrolysate. LWT, 153, 112414, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)NCC(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C44H67N11O15/c1-24(58)36(44(69)70)53-35(61)21-47-37(62)29(19-25-11-13-26(59)14-12-25)51-40(65)31(23-57)52-38(63)27(7-2-3-15-45)50-39(64)30(22-56)49-34(60)20-48-41(66)32-9-5-17-54(32)43(68)33-10-6-18-55(33)42(67)28-8-4-16-46-28/h11-14,24,27-33,36,46,56-59H,2-10,15-23,45H2,1H3,(H,47,62)(H,48,66)(H,49,60)(H,50,64)(H,51,65)(H,52,63)(H,53,61)(H,69,70)/t24-,27+,28+,29+,30+,31+,32+,33+,36+/m1/s1 InChIKey=RYLJIOLFHQQYGG-AUXZHWPXSA-N Bioactivity predicted using molecular docking |
| Database reference: |