BIOPEP-UWM: Report
| ID | 12 |
| Name | DPPIV inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Dipeptidyl peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) (PDB ID: 1PFQ) | |||
| Number of residues | 11 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 1270.4509 | Monoisotopic mass | 1269.6043 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Garzón A. G., Veras F. F., Brandelli A., Drago S. R. | |
| Title | |
| Purification, identification and in silico studies of antioxidant, antidiabetogenic and antibacterial peptides obtained from sorghum spent grain hydrolysate. LWT, 153, 112414, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C58H87N13O17S/c1-31(2)26-40(53(82)66-39(58(87)88)22-25-89-5)64-46(75)30-62-51(80)41(28-35-16-18-36(73)19-17-35)67-54(83)42(27-34-12-7-6-8-13-34)68-56(85)48(33(4)72)70-52(81)38(14-9-10-23-59)65-55(84)44-15-11-24-71(44)57(86)43(29-47(76)77)69-49(78)32(3)63-50(79)37(60)20-21-45(61)74/h6-8,12-13,16-19,31-33,37-44,48,72-73H,9-11,14-15,20-30,59-60H2,1-5H3,(H2,61,74)(H,62,80)(H,63,79)(H,64,75)(H,65,84)(H,66,82)(H,67,83)(H,68,85)(H,69,78)(H,70,81)(H,76,77)(H,87,88)/t32-,33+,37-,38-,39-,40-,41-,42-,43-,44-,48-/m0/s1 InChIKey=FECWYOLDHDGRDU-UTSVTYMMSA-N Bioactivity predicted using molecular docking |
| Database reference: |