BIOPEP-UWM: Report
| ID | 123 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Predicted ligand of SARS-CoV-2 parent protease (EC 3.4.22.69) (MEROPS ID: C30.007) (PDB ID: 6LU7) | |||
| Number of residues | 5 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 574.5799 | Monoisotopic mass | 574.2589 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yu Z., Kan R., Ji H., Wu S., Zhao W., Shuian D., Liu J., Li J. | |
| Title | |
| Identification of tuna protein-derived peptides as potent SARS-CoV-2 inhibitors via molecular docking and molecular dynamic simulation. Food Chem., 342, 128366, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C23H38N6O11/c1-10(2)18(25)22(38)26-11(3)19(35)27-13(5-8-16(31)32)20(36)28-12(4-7-15(24)30)21(37)29-14(23(39)40)6-9-17(33)34/h10-14,18H,4-9,25H2,1-3H3,(H2,24,30)(H,26,38)(H,27,35)(H,28,36)(H,29,37)(H,31,32)(H,33,34)(H,39,40)/t11-,12-,13-,14-,18-/m0/s1 InChIKey=CVGALJCLYJWUGG-NTIKPUAMSA-N Bioactivity predicted using molecular docking |
| Database reference: |