BIOPEP-UWM: Report
| ID | 136 |
| Name | Bitterness suppressing peptide |
| sequence |
| Function: | |||
| Predicted ligand of bitternes receptor T2R14 (BitterDB ID: 14) | |||
| Number of residues | 5 |
Activity code | bis |
| Activity : | bitterness suppressing |
|||
| Chemical mass | 571.6862 | Monoisotopic mass | 571.2666 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yu Z., Wang Y., Zhao W., Li J., Shuian D., Liu J. | |
| Title | |
| Identification of Oncorhynchus mykiss nebulin-derived peptides as bitter taste receptor TAS2R14 blockers by in silico screening and molecular docking. Food Chem., 368, 130839, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C25H41N5O8S/c1-4-14(2)20(26)24(36)30-11-6-8-18(30)23(35)29-10-5-7-17(29)22(34)28-16(13-19(31)32)21(33)27-15(25(37)38)9-12-39-3/h14-18,20H,4-13,26H2,1-3H3,(H,27,33)(H,28,34)(H,31,32)(H,37,38)/t14-,15-,16-,17-,18-,20-/m0/s1 InChIKey=FCWQZNBCLUGKAC-CPVUPJMFSA-N Bioactivity predicted using molecular docking |
| Database reference: |