BIOPEP-UWM: Report
| ID | 137 |
| Name | Bitterness suppressing peptide |
| sequence |
| Function: | |||
| Predicted ligand of bitternes receptor T2R14 (BitterDB ID: 14) | |||
| Number of residues | 3 |
Activity code | bis |
| Activity : | bitterness suppressing |
|||
| Chemical mass | 300.3531 | Monoisotopic mass | 300.1792 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yu Z., Wang Y., Zhao W., Li J., Shuian D., Liu J. | |
| Title | |
| Identification of Oncorhynchus mykiss nebulin-derived peptides as bitter taste receptor TAS2R14 blockers by in silico screening and molecular docking. Food Chem., 368, 130839, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: [H][C@@](CCCCN)(NC(=O)CN)C(=O)N1CCC[C@@]1([H])C(O)=O InChI=1S/C13H24N4O4/c14-6-2-1-4-9(16-11(18)8-15)12(19)17-7-3-5-10(17)13(20)21/h9-10H,1-8,14-15H2,(H,16,18)(H,20,21)/t9-,10-/m0/s1 InChIKey=WDEHMRNSGHVNOH-UWVGGRQHSA-N Bioactivity predicted using molecular docking Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BindingDB database; the BIOPEP-UWM database of bioactive peptides (ID 3506); the ChEMBL database; the EROP-Moscow database; the PlantPepDB database; the PubChem database |
| Database reference: |
| AHTPDB: ID 1587, 1663, 2252, 2578, 2852, 3924, 4073, 4797, 5207, 5564, 5589, 5946, 6425, 6863 BindingDB: ID 50049795 BIOPEP-UWM database of bioactive peptides: ID 3506 ChEMBL: ID CHEMBL3322008 ChemSpider: ID 58113011 EROP-Moscow: ID E09244 FeptideDB: ID 3506 PlantPepDB: ID PPepDB_2909 PubChem: CID 53308269 SATPdb: ID satpdb15034 ZINC: ID ZINC000039817963 |