BIOPEP-UWM: Report
| ID | 138 |
| Name | Bitterness suppressing peptide |
| sequence |
| Function: | |||
| Predicted ligand of bitternes receptor T2R14 (BitterDB ID: 14) | |||
| Number of residues | 2 |
Activity code | bis |
| Activity : | bitterness suppressing |
|||
| Chemical mass | 264.2992 | Monoisotopic mass | 264.0776 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yu Z., Wang Y., Zhao W., Li J., Shuian D., Liu J. | |
| Title | |
| Identification of Oncorhynchus mykiss nebulin-derived peptides as bitter taste receptor TAS2R14 blockers by in silico screening and molecular docking. Food Chem., 368, 130839, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C9H16N2O5S/c1-17-3-2-6(9(15)16)11-8(14)5(10)4-7(12)13/h5-6H,2-4,10H2,1H3,(H,11,14)(H,12,13)(H,15,16)/t5-,6-/m0/s1 InChIKey: DYDKXJWQCIVTMR-WDSKDSINSA-N Bioactivity predicted using molecular docking Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BIOPEP-UWM database of bioactive peptides (ID 9075); the PubChem database |
| Database reference: |
| AHTPDB: ID 1398, 4713, 5142, 6167 BioPepDB: ID biopep00145 BIOPEP-UWM database of bioactive peptides: ID 9075 ChemSpider: ID 8032284 SATPdb: ID satpdb11083 |