BIOPEP-UWM: Report
| ID | 142 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Peptide predicted to bind DPPH• (PubChem CID 2735032) and ABTS•+ (PubChem CID 90658258) | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1077.2488 | Monoisotopic mass | 1076.5194 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li C., Mora L., Toldrá F. | |
| Title | |
| Structure-function relationship of small peptides generated during the ripening of Spanish dry-cured ham: Peptidome, molecular stability and computational modelling. Food Chem., 375, 131673, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CS)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C49H76N10O15S/c1-25(2)17-30(50)41(65)57-36(24-75)48(72)59-16-8-10-38(59)46(70)56-35(23-60)47(71)58-15-7-9-37(58)45(69)54-33(21-40(63)64)42(66)51-22-39(62)52-31(18-26(3)4)43(67)53-32(20-28-11-13-29(61)14-12-28)44(68)55-34(49(73)74)19-27(5)6/h11-14,25-27,30-38,60-61,75H,7-10,15-24,50H2,1-6H3,(H,51,66)(H,52,62)(H,53,67)(H,54,69)(H,55,68)(H,56,70)(H,57,65)(H,63,64)(H,73,74)/t30-,31-,32-,33-,34-,35-,36-,37-,38-/m0/s1 InChIKey=MYZXWRWRCKQLFR-IWLMWFOOSA-N Bioactivity predicted using molecular docking |
| Database reference: |