BIOPEP-UWM: Report
| ID | 182 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) (PDB ID: 1O86) | |||
| Number of residues | 10 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 1109.2694 | Monoisotopic mass | 1108.6108 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ding Z., Chen K., Chen Y. | |
| Title | |
| Research on ACEI of low‐molecular‐weight peptides from Hirudo nipponia Whitman. Molecules, 27, 5421, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O InChI=1S/C50H84N12O16/c1-27(2)22-32(42(69)55-31(13-6-8-18-52)48(75)61-20-10-16-38(61)46(73)59-35(50(77)78)25-40(66)67)56-41(68)30(12-5-7-17-51)54-44(71)37-15-11-21-62(37)49(76)34(23-28(3)4)58-43(70)33(24-39(64)65)57-45(72)36-14-9-19-60(36)47(74)29(53)26-63/h27-38,63H,5-26,51-53H2,1-4H3,(H,54,71)(H,55,69)(H,56,68)(H,57,72)(H,58,70)(H,59,73)(H,64,65)(H,66,67)(H,77,78)/t29-,30-,31-,32-,33-,34-,35-,36-,37-,38-/m0/s1 InChIKey=XJYSELNUMQZHAP-YRYMBYOHSA-N Bioactivity predicted by molecular docking |
| Database reference: |