BIOPEP-UWM: Report
| ID | 185 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) (PDB ID: 1O86) | |||
| Number of residues | 7 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 829.0381 | Monoisotopic mass | 828.5206 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ding Z., Chen K., Chen Y. | |
| Title | |
| Research on ACEI of low‐molecular‐weight peptides from Hirudo nipponia Whitman. Molecules, 27, 5421, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C41H68N10O8/c1-23(2)19-29(47-34(52)26(7)42)36(54)48-31(21-25(5)6)37(55)50-32(22-27-13-9-8-10-14-27)38(56)49-30(20-24(3)4)35(53)46-28(15-11-17-45-41(43)44)39(57)51-18-12-16-33(51)40(58)59/h8-10,13-14,23-26,28-33H,11-12,15-22,42H2,1-7H3,(H,46,53)(H,47,52)(H,48,54)(H,49,56)(H,50,55)(H,58,59)(H4,43,44,45)/t26-,28-,29-,30-,31-,32-,33-/m0/s1 InChIKey=VDTBVPDAZSIVHR-VJBGVNKVSA-N Bioactivity predicted by molecular docking |
| Database reference: |