BIOPEP-UWM: Report
| ID | 224 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Peptide predicted to bind DPPH• (PubChem CID 2735032) and ABTS•+ (PubChem CID 90658258) | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 661.7016 | Monoisotopic mass | 661.3061 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhu Z., Chen Y., Jia N., Zhang W., Hou H., Xue C., Wang Y. | |
| Title | |
| Identification of three novel antioxidative peptides from Auxenochlorella pyrenoidosa protein hydrolysates based on a peptidomics strategy. Food Chemistry, 375, 131849, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)O InChI=1S/C30H43N7O10/c1-16(2)11-19(27(44)33-15-25(41)42)35-29(46)22-9-6-10-37(22)30(47)21(14-24(39)40)36-28(45)20(12-17-7-4-3-5-8-17)34-26(43)18(31)13-23(32)38/h3-5,7-8,16,18-22H,6,9-15,31H2,1-2H3,(H2,32,38)(H,33,44)(H,34,43)(H,35,46)(H,36,45)(H,39,40)(H,41,42)/t18-,19-,20-,21-,22-/m0/s1 InChIKey= AXRSGGYYNVIPEB-YFNVTMOMSA-N Bioactivity predicted using QSAR |
| Database reference: |