BIOPEP-UWM: Report
| ID | 226 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Peptide predicted to bind DPPH• (PubChem CID 2735032) and ABTS•+ (PubChem CID 90658258) | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 547.5992 | Monoisotopic mass | 547.2633 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhu Z., Chen Y., Jia N., Zhang W., Hou H., Xue C., Wang Y. | |
| Title | |
| Identification of three novel antioxidative peptides from Auxenochlorella pyrenoidosa protein hydrolysates based on a peptidomics strategy. Food Chemistry, 375, 131849, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)O InChI=1S/C26H37N5O8/c1-15(2)11-18(24(37)28-14-22(34)35)29-25(38)20-9-6-10-31(20)26(39)19(13-21(32)33)30-23(36)17(27)12-16-7-4-3-5-8-16/h3-5,7-8,15,17-20H,6,9-14,27H2,1-2H3,(H,28,37)(H,29,38)(H,30,36)(H,32,33)(H,34,35)/t17-,18-,19-,20-/m0/s1 InChIKey= XGADXGUALBOOHX-MUGJNUQGSA-N Bioactivity predicted using QSAR |
| Database reference: |