BIOPEP-UWM: Report
| ID | 227 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Peptide predicted to bind DPPH• (PubChem CID 2735032) and ABTS•+ (PubChem CID 90658258) | |||
| Number of residues | 13 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1384.4844 | Monoisotopic mass | 1383.6325 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhu Z., Chen Y., Jia N., Zhang W., Hou H., Xue C., Wang Y. | |
| Title | |
| Identification of three novel antioxidative peptides from Auxenochlorella pyrenoidosa protein hydrolysates based on a peptidomics strategy. Food Chemistry, 375, 131849, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)O InChI=1S/C66H89N13O20/c1-36(2)25-43(58(91)70-34-56(88)89)74-64(97)51-18-12-24-79(51)66(99)48(31-55(86)87)76-61(94)46(28-39-15-9-6-10-16-39)73-60(93)45(27-38-13-7-5-8-14-38)71-53(83)33-68-52(82)32-69-63(96)50-17-11-23-78(50)65(98)47(29-40-19-21-41(81)22-20-40)75-59(92)44(26-37(3)4)72-62(95)49(35-80)77-57(90)42(67)30-54(84)85/h5-10,13-16,19-22,36-37,42-51,80-81H,11-12,17-18,23-35,67H2,1-4H3,(H,68,82)(H,69,96)(H,70,91)(H,71,83)(H,72,95)(H,73,93)(H,74,97)(H,75,92)(H,76,94)(H,77,90)(H,84,85)(H,86,87)(H,88,89)/t42-,43-,44-,45-,46-,47-,48-,49-,50-,51-/m0/s1 InChIKey= DLNRGLUWTIXJDZ-RJEWGMQKSA-N Bioactivity predicted using QSAR |
| Database reference: |