BIOPEP-UWM: Report
| ID | 23 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Predicted ligand of SARS-CoV-2 parent protease (EC 3.4.22.69) (MEROPS ID: C30.007) (PDB: 6LU7) | |||
| Number of residues | 5 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 567.5873 | Monoisotopic mass | 567.2531 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Yao Y., Luo Z., Zhang X. | |
| Title | |
| In silico evaluation of marine fish proteins as nutritional supplement for COVID-2019 patients. Food Funct., 11, 5565-5572, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C25H37N5O10/c1-12(32)19(26)23(37)29-20(13(2)33)24(38)30-9-3-4-18(30)22(36)28-17(11-31)21(35)27-16(25(39)40)10-14-5-7-15(34)8-6-14/h5-8,12-13,16-20,31-34H,3-4,9-11,26H2,1-2H3,(H,27,35)(H,28,36)(H,29,37)(H,39,40)/t12-,13-,16+,17+,18+,19+,20+/m1/s1 InChIKey=GYOIGUOFEZKDMC-OWIALGGXSA-N Bioactivity predicted using molecular docking |
| Database reference: |