BIOPEP-UWM: Report
| ID | 232 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Peptide predicted to bind DPPH• (PubChem CID 2735032) and ABTS•+ (PubChem CID 90658258) | |||
| Number of residues | 7 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 718.7528 | Monoisotopic mass | 718.3275 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhu Z., Chen Y., Jia N., Zhang W., Hou H., Xue C., Wang Y. | |
| Title | |
| Identification of three novel antioxidative peptides from Auxenochlorella pyrenoidosa protein hydrolysates based on a peptidomics strategy. Food Chemistry, 375, 131849, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: NCC(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)O InChI=1S/C32H46N8O11/c1-17(2)11-19(28(47)35-16-27(45)46)38-31(50)23-9-6-10-40(23)32(51)22(14-26(43)44)39-29(48)20(12-18-7-4-3-5-8-18)37-30(49)21(13-24(34)41)36-25(42)15-33/h3-5,7-8,17,19-23H,6,9-16,33H2,1-2H3,(H2,34,41)(H,35,47)(H,36,42)(H,37,49)(H,38,50)(H,39,48)(H,43,44)(H,45,46)/t19-,20-,21-,22-,23-/m0/s1 InChIKey= GWALEVHCAUCMLI-VUBDRERZSA-N Bioactivity predicted using QSAR |
| Database reference: |