BIOPEP-UWM: Report
| ID | 235 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Peptide predicted to bind DPPH• (PubChem CID 2735032) and ABTS•+ (PubChem CID 90658258) | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 585.7329 | Monoisotopic mass | 585.3515 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhu Z., Chen Y., Jia N., Zhang W., Hou H., Xue C., Wang Y. | |
| Title | |
| Identification of three novel antioxidative peptides from Auxenochlorella pyrenoidosa protein hydrolysates based on a peptidomics strategy. Food Chemistry, 375, 131849, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C31H47N5O6/c1-19(2)16-23(33-27(37)22(32)18-21-10-6-5-7-11-21)29(39)35-14-8-12-25(35)28(38)34-24(17-20(3)4)30(40)36-15-9-13-26(36)31(41)42/h5-7,10-11,19-20,22-26H,8-9,12-18,32H2,1-4H3,(H,33,37)(H,34,38)(H,41,42)/t22-,23-,24-,25-,26-/m0/s1 InChIKey= GCCCDUOFJUZSMY-LROMGURASA-N Bioactivity predicted using QSAR |
| Database reference: |