BIOPEP-UWM: Report
| ID | 242 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Peptide predicted to bind DPPH• (PubChem CID 2735032) and ABTS•+ (PubChem CID 90658258) | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 694.7727 | Monoisotopic mass | 694.3315 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhu Z., Chen Y., Jia N., Zhang W., Hou H., Xue C., Wang Y. | |
| Title | |
| Identification of three novel antioxidative peptides from Auxenochlorella pyrenoidosa protein hydrolysates based on a peptidomics strategy. Food Chemistry, 375, 131849, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)NCC(=O)O InChI=1S/C35H46N6O9/c1-21(2)16-25(32(47)37-20-30(44)45)39-34(49)28-14-9-15-41(28)35(50)27(19-29(42)43)40-33(48)26(18-23-12-7-4-8-13-23)38-31(46)24(36)17-22-10-5-3-6-11-22/h3-8,10-13,21,24-28H,9,14-20,36H2,1-2H3,(H,37,47)(H,38,46)(H,39,49)(H,40,48)(H,42,43)(H,44,45)/t24-,25-,26-,27-,28-/m0/s1 InChIKey= CVLVDZUTIMZUQE-XLIKFSOKSA-N Bioactivity predicted using QSAR |
| Database reference: |