BIOPEP-UWM: Report
| ID | 244 |
| Name | Farnesyltransferase inhibitor |
| sequence |
| Function: | |||
| Predicted ligand of farnesyltransferase (EC 2.5.1.58) (PDB ID: 2H6I) | |||
| Number of residues | 6 |
Activity code | far |
| Activity : | farnesyltransferase inhibitor |
|||
| Chemical mass | 646.8628 | Monoisotopic mass | 646.3171 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fatoki T. H., Aluko R. E., Udenigwe C. C. | |
| Title | |
| In silico investigation of molecular targets, pharmacokinetics, and biological activities of chicken egg ovalbumin protein hydrolysates. J. Food Bioact., 17, 34–48, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CS)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C28H50N6O7S2/c1-7-15(3)21(33-24(36)20-10-9-12-34(20)27(39)18(29)14-42)25(37)30-17(5)23(35)32-22(16(4)8-2)26(38)31-19(28(40)41)11-13-43-6/h15-22,42H,7-14,29H2,1-6H3,(H,30,37)(H,31,38)(H,32,35)(H,33,36)(H,40,41)/t15-,16-,17-,18-,19-,20-,21-,22-/m0/s1 InChIKey=HYXBZRVEGQEIAR-JOFXYRRGSA-N Bioactivity predicted using molecular docking |
| Database reference: |