BIOPEP-UWM: Report
| ID | 246 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) (PDB ID: 1O86) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 217.2647 | Monoisotopic mass | 217.1422 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chai T.-T., Wong C.C.-C., Sabri M.Z., Wong F.-C. | |
| Title | |
| Seafood Paramyosins as Sources of AntiAngiotensin-Converting-Enzyme and Anti-Dipeptidyl-Peptidase Peptides after Gastrointestinal Digestion:A Cheminformatic Investigation. Molecules., 27, 3864, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C9H19N3O3/c1-6(11)8(13)12-7(9(14)15)4-2-3-5-10/h6-7H,2-5,10-11H2,1H3,(H,12,13)(H,14,15)/t6-,7-/m0/s1 InChIKey= QXRNAOYBCYVZCD-BQBZGAKWSA-N Bioactivity predicted by molecular docking |
| Database reference: |
| BindingDB: ID BDBM50169125 BRENDA: Ligand Ala-Lys CAS: Registry No 6366-77-4 ChEBI: ID 132403 ChEMBL: ID CHEMBL191057 Chemspider: ID 5379128 EPA CompTox: ID DTXSID30426799 FooDB: ID DB111751 HMDB: ID HMDB0028692 J-GLOBAL: ID 200907030025108155 Metabolights: ID MTBLC132403 Metabolomics Workbench: ID 78667 Nikkaji: ID J81.207B NMRShiftDB: ID 80004383 PubChem: CID 7016106 SureChEMBL: ID SCHEMBL1711244 ZINC: ID ZINC000002522662 |