BIOPEP-UWM: Report
| ID | 247 |
| Name | DPPIV inhibitor |
| sequence |
| Function: | |||
| Predicted inhibitor of Dipeptidyl peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) (PDB ID: 5I7U) | |||
| Number of residues | 3 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 315.4073 | Monoisotopic mass | 315.2151 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Chai T.-T., Wong C.C.-C., Sabri M.Z., Wong F.-C. | |
| Title | |
| Seafood Paramyosins as Sources of AntiAngiotensin-Converting-Enzyme and Anti-Dipeptidyl-Peptidase Peptides after Gastrointestinal Digestion:A Cheminformatic Investigation. Molecules., 27, 3864, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C15H29N3O4/c1-6-9(4)12(16)14(20)17-10(5)13(19)18-11(15(21)22)7-8(2)3/h8-12H,6-7,16H2,1-5H3,(H,17,20)(H,18,19)(H,21,22)/t9-,10-,11-,12-/m0/s1 InChIKey= VAXBXNPRXPHGHG-BJDJZHNGSA-N Bioactivity predicted by molecular docking |
| Database reference: |
| ChEBI: ID 158146 Metabolomics Workbench: ID 82666 PubChem: CID 145456040 |