BIOPEP-UWM: Report
| ID | 249 |
| Name | Predicted antioxidative peptide |
| sequence |
| Function: | |||
| Predicted ligand of murine Keap1 (PDB ID: 5CGJ) | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 931.9875 | Monoisotopic mass | 931.4708 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ong J.-H., Koh J.-A., Cao H., Tan S.-A., Manan F. A., Wong F.-C., Chai T.-T. | |
| Title | |
| Purification, identification and characterization of antioxidant peptides from corn silk tryptic hydrolysate: an integrated in vitro-in silico approach. Antioxidants, 10, 1822, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CO)C(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)NCC(=O)NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C37H65N13O15/c1-17(2)11-22(31(59)46-21(36(64)65)7-5-9-41-37(39)40)47-32(60)23(15-52)45-27(56)13-42-26(55)12-43-34(62)28(19(4)54)49-29(57)18(3)44-33(61)25-8-6-10-50(25)35(63)24(16-53)48-30(58)20(38)14-51/h17-25,28,51-54H,5-16,38H2,1-4H3,(H,42,55)(H,43,62)(H,44,61)(H,45,56)(H,46,59)(H,47,60)(H,48,58)(H,49,57)(H,64,65)(H4,39,40,41)/t18-,19+,20-,21-,22-,23-,24-,25-,28-/m0/s1 InChIKey= BXROVCCLWJHYCP-LZVXBMTQSA-N Preliminary predictions were done using QSAR (program AnOxPePred). Interactions between peptide and receptors were predicted using molecular docking. |
| Database reference: |