BIOPEP-UWM: Report
| ID | 250 |
| Name | Predicted antioxidative peptide |
| sequence |
| Function: | |||
| Predicted ligand of murine Keap1 (PDB ID: 5CGJ) and human MPO (EC 1.11.2.2; PDB ID: 5CGJ) | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 750.7978 | Monoisotopic mass | 750.3649 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ong J.-H., Koh J.-A., Cao H., Tan S.-A., Manan F. A., Wong F.-C., Chai T.-T. | |
| Title | |
| Purification, identification and characterization of antioxidant peptides from corn silk tryptic hydrolysate: an integrated in vitro-in silico approach. Antioxidants, 10, 1822, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C32H50N10O11/c1-16(2)12-22(42-27(48)19(33)14-24(34)44)29(50)40-20(9-10-26(46)47)28(49)38-15-25(45)39-23(13-17-5-7-18(43)8-6-17)30(51)41-21(31(52)53)4-3-11-37-32(35)36/h5-8,16,19-23,43H,3-4,9-15,33H2,1-2H3,(H2,34,44)(H,38,49)(H,39,45)(H,40,50)(H,41,51)(H,42,48)(H,46,47)(H,52,53)(H4,35,36,37)/t19-,20-,21-,22-,23-/m0/s1 InChIKey= XQJSWUKPXODVFE-VUBDRERZSA-N Preliminary predictions were done using QSAR (program AnOxPePred). Interactions between peptide and receptors were predicted using molecular docking. |
| Database reference: |