BIOPEP-UWM: Report
| ID | 251 |
| Name | Predicted antioxidative peptide |
| sequence |
| Function: | |||
| Predicted ligand of human MPO (EC 1.11.2.2; PDB ID: 5CGJ) | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 668.7041 | Monoisotopic mass | 668.3458 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ong J.-H., Koh J.-A., Cao H., Tan S.-A., Manan F. A., Wong F.-C., Chai T.-T. | |
| Title | |
| Purification, identification and characterization of antioxidant peptides from corn silk tryptic hydrolysate: an integrated in vitro-in silico approach. Antioxidants, 10, 1822, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)NCC(=O)N[C@@]([H])(CO)C(=O)NCC(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C25H44N14O8/c26-14(3-1-5-32-24(27)28)20(43)39-16(7-13-8-31-12-36-13)21(44)34-10-19(42)38-17(11-40)22(45)35-9-18(41)37-15(23(46)47)4-2-6-33-25(29)30/h8,12,14-17,40H,1-7,9-11,26H2,(H,31,36)(H,34,44)(H,35,45)(H,37,41)(H,38,42)(H,39,43)(H,46,47)(H4,27,28,32)(H4,29,30,33)/t14-,15-,16-,17-/m0/s1 InChIKey= OKFXZAGNRGKNEK-QAETUUGQSA-N Preliminary predictions were done using QSAR (program AnOxPePred). Interactions between peptide and receptors were predicted using molecular docking. |
| Database reference: |