BIOPEP-UWM: Report
| ID | 252 |
| Name | Predicted antioxidative peptide |
| sequence |
| Function: | |||
| Predicted ligand of human MPO (EC 1.11.2.2; PDB ID: 5CGJ) | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 897.0756 | Monoisotopic mass | 896.5330 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ong J.-H., Koh J.-A., Cao H., Tan S.-A., Manan F. A., Wong F.-C., Chai T.-T. | |
| Title | |
| Purification, identification and characterization of antioxidant peptides from corn silk tryptic hydrolysate: an integrated in vitro-in silico approach. Antioxidants, 10, 1822, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C42H68N14O8/c43-20-6-4-12-29(45)35(58)52-31(14-8-22-50-41(46)47)37(60)55-34(25-27-16-18-28(57)19-17-27)39(62)56-33(24-26-10-2-1-3-11-26)38(61)53-30(13-5-7-21-44)36(59)54-32(40(63)64)15-9-23-51-42(48)49/h1-3,10-11,16-19,29-34,57H,4-9,12-15,20-25,43-45H2,(H,52,58)(H,53,61)(H,54,59)(H,55,60)(H,56,62)(H,63,64)(H4,46,47,50)(H4,48,49,51)/t29-,30-,31-,32-,33-,34-/m0/s1 InChIKey= VYHRRSSOVBAAML-CVUOCSEZSA-N Preliminary predictions were done using QSAR (program AnOxPePred). Interactions between peptide and receptors were predicted using molecular docking. |
| Database reference: |