BIOPEP-UWM: Report
| ID | 253 |
| Name | Predicted antioxidative peptide |
| sequence |
| Function: | |||
| Predicted ligand of murine Keap1 (PDB ID: 5CGJ) | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1027.0899 | Monoisotopic mass | 1026.5191 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ong J.-H., Koh J.-A., Cao H., Tan S.-A., Manan F. A., Wong F.-C., Chai T. -T. | |
| Title | |
| Purification, identification and characterization of antioxidant peptides from corn silk tryptic hydrolysate: an integrated in vitro-in silico approach. Antioxidants, 10, 1822, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C41H70N16O15/c1-18(2)13-24(55-38(69)26(17-58)56-37(68)25(15-30(45)61)54-33(64)20(4)50-34(65)21(42)14-29(44)60)36(67)51-19(3)32(63)49-16-31(62)57-12-6-8-27(57)39(70)52-22(9-10-28(43)59)35(66)53-23(40(71)72)7-5-11-48-41(46)47/h18-27,58H,5-17,42H2,1-4H3,(H2,43,59)(H2,44,60)(H2,45,61)(H,49,63)(H,50,65)(H,51,67)(H,52,70)(H,53,66)(H,54,64)(H,55,69)(H,56,68)(H,71,72)(H4,46,47,48)/t19-,20-,21-,22-,23-,24-,25-,26-,27-/m0/s1 InChIKey= KDDVNOYHSAMXBI-JOXZBDCSSA-N Preliminary predictions were done using QSAR (program AnOxPePred). Interactions between peptide and receptors were predicted using molecular docking. |
| Database reference: |