BIOPEP-UWM: Report
| ID | 254 |
| Name | Predicted antioxidative peptide |
| sequence |
| Function: | |||
| Predicted ligand of murine Keap1 (PDB ID: 5CGJ) and human MPO (EC 1.11.2.2; PDB ID: 5CGJ) | |||
| Number of residues | 6 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 672.7964 | Monoisotopic mass | 672.3367 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ong J.-H., Koh J.-A., Cao H., Tan S.-A., Manan F. A., Wong F.-C., Chai T.-T. | |
| Title | |
| Purification, identification and characterization of antioxidant peptides from corn silk tryptic hydrolysate: an integrated in vitro-in silico approach. Antioxidants, 10, 1822, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C27H48N10O8S/c1-14(2)21(36-23(41)16(8-11-46-3)35-22(40)15(28)12-19(29)38)25(43)37-10-5-7-18(37)24(42)33-13-20(39)34-17(26(44)45)6-4-9-32-27(30)31/h14-18,21H,4-13,28H2,1-3H3,(H2,29,38)(H,33,42)(H,34,39)(H,35,40)(H,36,41)(H,44,45)(H4,30,31,32)/t15-,16-,17-,18-,21-/m0/s1 InChIKey= RCVFRYWLWLOIHN-SOADLSRISA-N Preliminary predictions were done using QSAR (program AnOxPePred). Interactions between peptide and receptors were predicted using molecular docking. |
| Database reference: |