BIOPEP-UWM: Report
| ID | 264 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Predicted ligand of angiotensin-converting enzyme (EC 3.4.15.1) (PDB ID: 4C2N) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 446.4956 | Monoisotopic mass | 446.2158 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fatoki T. H., Aluko R. E., Udenigwe C. C. | |
| Title | |
| In silico investigation of molecular targets, pharmacokinetics, and biological activities of chicken egg ovalbumin protein hydrolysates. J. Food Bioact., 17, 34–48, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C22H30N4O6/c1-12(2)9-15(23)20(29)26-18(10-13-11-24-16-6-4-3-5-14(13)16)21(30)25-17(22(31)32)7-8-19(27)28/h3-6,11-12,15,17-18,24H,7-10,23H2,1-2H3,(H,25,30)(H,26,29)(H,27,28)(H,31,32)/t15-,17-,18-/m0/s1 InChIKey=WGAZVKFCPHXZLO-SZMVWBNQSA-N Bioactivity predicted using molecular docking |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 8007 ChEBI: ID 159563 Metabolomics Workbench: ID 83402 PubChem: CID 145456534 |