BIOPEP-UWM: Report
| ID | 270 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Predicted ligand of Lipoxin A4 receptor (PDB ID: 6LW5) | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 488.5767 | Monoisotopic mass | 488.2949 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fatoki T. H., Aluko R. E., Udenigwe C. C. | |
| Title | |
| In silico investigation of molecular targets, pharmacokinetics, and biological activities of chicken egg ovalbumin protein hydrolysates. J. Food Bioact., 17, 34–48, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C21H40N6O7/c1-4-11(2)16(26-18(30)13(23)8-9-15(24)29)19(31)27-17(12(3)28)20(32)25-14(21(33)34)7-5-6-10-22/h11-14,16-17,28H,4-10,22-23H2,1-3H3,(H2,24,29)(H,25,32)(H,26,30)(H,27,31)(H,33,34)/t11-,12+,13-,14-,16-,17-/m0/s1 InChIKey=GJMRIDOXQABVGE-KHYRULFTSA-N Bioactivity predicted using molecular docking |
| Database reference: |