BIOPEP-UWM: Report
| ID | 271 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Predicted ligand of Lipoxin A4 receptor (PDB ID: 6LW5) | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 301.3379 | Monoisotopic mass | 301.1632 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fatoki T. H., Aluko R. E., Udenigwe C. C. | |
| Title | |
| In silico investigation of molecular targets, pharmacokinetics, and biological activities of chicken egg ovalbumin protein hydrolysates. J. Food Bioact., 17, 34–48, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C13H23N3O5/c1-7(2)10(14)11(18)15-8(6-17)12(19)16-5-3-4-9(16)13(20)21/h7-10,17H,3-6,14H2,1-2H3,(H,15,18)(H,20,21)/t8-,9-,10-/m0/s1 InChIKey=GBIUHAYJGWVNLN-GUBZILKMSA-N Bioactivity predicted using molecular docking Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BindingDB database; the BIOPEP-UWM database of bioactive peptides (ID 3538); the ChEMBL database; the DFBP database; the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 1638, 2237, 3153, 4047, 4808, 5265, 5631, 5802, 5872, 6455 BindingDB: ID BDBM50049723 BIOPEP-UWM database of bioactive peptides: ID 3538 ChEMBL: ID CHEMBL3322003 DFBP: ID DFBPACEI0582; DFBPACEI1935 EROP-Moscow: ID E14714 PubChem: CID 118709853 SATPdb: ID satpdb27914 ZINC: ID ZINC000238763778 |