BIOPEP-UWM: Report
| ID | 272 |
| Name | Cathepsin B inhibitor |
| sequence |
| Function: | |||
| Predicted ligand of cathepsin B (EC: 3.4.22.1) (MEROPS ID: C01.060; PDB ID: 2PBH) | |||
| Number of residues | 3 |
Activity code | catb |
| Activity : | cathepsin B inhibitor |
|||
| Chemical mass | 274.3159 | Monoisotopic mass | 274.1636 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fatoki T. H., Aluko R. E., Udenigwe C. C. | |
| Title | |
| In silico investigation of molecular targets, pharmacokinetics, and biological activities of chicken egg ovalbumin protein hydrolysates. J. Food Bioact., 17, 34–48, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: NCC(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C11H22N4O4/c1-7(14-9(16)6-13)10(17)15-8(11(18)19)4-2-3-5-12/h7-8H,2-6,12-13H2,1H3,(H,14,16)(H,15,17)(H,18,19)/t7-,8-/m0/s1 InChIKey=JBRBACJPBZNFMF-YUMQZZPRSA-N Bioactivity predicted using molecular docking |
| Database reference: |
| CAS: Registry No 71227-71-9 ChEBI: ID 163428 EPA CompTox: ID DTXSID70825520 Metabolomics Workbench: ID 81867 PubChem: CID 71404690 |