BIOPEP-UWM: Report
| ID | 273 |
| Name | Furin inhibitor |
| sequence |
| Function: | |||
| Predicted ligand of furin (EC 3.4.21.75) (MEROPS ID: S08.071; PDB ID: 6HLD) | |||
| Number of residues | 3 |
Activity code | fur |
| Activity : | furin inhibitor |
|||
| Chemical mass | 372.4618 | Monoisotopic mass | 372.2478 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fatoki T. H., Aluko R. E., Udenigwe C. C. | |
| Title | |
| In silico investigation of molecular targets, pharmacokinetics, and biological activities of chicken egg ovalbumin protein hydrolysates. J. Food Bioact., 17, 34–48, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C16H32N6O4/c1-8(2)11(17)13(23)22-12(9(3)4)14(24)21-10(15(25)26)6-5-7-20-16(18)19/h8-12H,5-7,17H2,1-4H3,(H,21,24)(H,22,23)(H,25,26)(H4,18,19,20)/t10-,11-,12-/m0/s1 InChIKey=RTJPAGFXOWEBAI-SRVKXCTJSA-N Bioactivity predicted using molecular docking Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 9729) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9729 ChEBI: ID 166433 ChemSpider: ID 16576092 Metabolomic Workbench: ID 87037 PubChem: CID 25123284 |