BIOPEP-UWM: Report
| ID | 274 |
| Name | Furin inhibitor |
| sequence |
| Function: | |||
| Predicted ligand of furin (EC 3.4.21.75) (MEROPS ID: S08.071; PDB ID: 6HLD) | |||
| Number of residues | 4 |
Activity code | fur |
| Activity : | furin inhibitor |
|||
| Chemical mass | 457.5660 | Monoisotopic mass | 457.3004 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fatoki T. H., Aluko R. E., Udenigwe C. C. | |
| Title | |
| In silico investigation of molecular targets, pharmacokinetics, and biological activities of chicken egg ovalbumin protein hydrolysates. J. Food Bioact., 17, 34–48, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: NCC(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C20H39N7O5/c1-5-11(3)15(26-14(28)10-21)18(30)27-16(12(4)6-2)17(29)25-13(19(31)32)8-7-9-24-20(22)23/h11-13,15-16H,5-10,21H2,1-4H3,(H,25,29)(H,26,28)(H,27,30)(H,31,32)(H4,22,23,24)/t11-,12-,13-,15-,16-/m0/s1 InChIKey=FTBUNQKJGJANGZ-IICXDKKESA-N Bioactivity predicted using molecular docking |
| Database reference: |