BIOPEP-UWM: Report
| ID | 291 |
| Name | Predicted antioxidative peptide |
| sequence |
| Function: | |||
| Predicted ligand of Keap1 (PDB ID: 6TYM) | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 473.5654 | Monoisotopic mass | 473.2953 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Sadiq I. Z., Katsayal B. S., Abdulazeez R., Adedoyin O. S., Omengwu Y. F., Usman A. G. | |
| Title | |
| Peptides from casein extend the survival rate and protect Drosophila melanogaster from oxidative stress via interacting with the Keap1-Nrf2 pathway. Jordan J. Biol. Sci., 16, 297–305, 2023 | |
| Year | Source |
| 2023 | Journal |
| Additional information: |
| BIOPEP-UWM Virtual database SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C20H39N7O6/c1-10(2)8-13(26-18(31)15(21)11(3)4)16(29)27-14(9-28)17(30)25-12(19(32)33)6-5-7-24-20(22)23/h10-15,28H,5-9,21H2,1-4H3,(H,25,30)(H,26,31)(H,27,29)(H,32,33)(H4,22,23,24)/t12-,13-,14-,15-/m0/s1 InChIKey=RQBGKEFSENCJPF-AJNGGQMLSA-N Activity predicted using molecular docking |
| Database reference: |